Biochem/physiol Actions
Orally bioavailable synthetic progestational agent that reversibly binds to progesterone receptors with high-affinity in the hypothalamus, pituitary gland, and uterus.
Levonorgestrel (D-Norgestrel) is an orally bioavailable synthetic progestational agent that reversibly binds to progesterone receptors with high-affinity in the hypothalamus, pituitary gland, and uterus. Levonorgestrel inhibits the release of gonadotropin-releasing hormone (GnRH), luteinizing hormone (LH), and follicle-stimulating hormone (FSH). D(−)-Norgestrel prevents fertilization by altering cervical mucus consistency, and interfering with the endometrial lining, making it less receptive to implantation. Levonorgestrel (LNG) can be used alone or in combination with estrogen during hormone replacement therapy.
| Quality Level | 100 |
| assay | ≥98% (HPLC) |
| form | powder |
| optical activity | [α]/D -28 to -36° (C= 1.0g/100 ml in CDCl3) |
| color | white to beige |
| solubility | DMSO: 2 mg/mL, clear |
| storage temp. | -10 to -25°C |
| SMILES string | O[C@@]1([C@@]2([C@H]([C@H]3[C@@H]([C@H]4CCC(=O)C=C4CC3)CC2)CC1)CC)C#C |
| InChI key | WWYNJERNGUHSAO-XUDSTZEESA-N |
