Biochem/physiol Actions
NG-497 is a non-cytotoxic, substrate-competitive, reversible and highly selective human/primate adipose triglyceride lipase (ATGL; IPLA2-zeta; PNPLA2) inhibitor (IC50 = 1 μM, Ki = 0.5 μM) with little activity toward related human lipid hydrolases or ATGL orthologues from other species (<20% inhibition of mouse, rat, goat, pig, dog, marmoset ATGL at 50 μM). NG-497 abolishes hormone-induced lipolysis in human adipocytes (IC50 = 1.5 and 0.5 μM against 1 μM isoproterenol-induced total or hormonesensitive lipase (HSL)-independent FA release in Simpson-Golabi-Behmel syndrome adipocytes), but not in HepG2 that lacks ATGL hydrolase activity.
Non-cytotoxic, substrate-competitive, reversible and highly selective human/primate adipose triglyceride lipase (ATGL; IPLA2-zeta; PNPLA2) inhibitor.
| Quality Segment | 100 |
| assay | ≥98% (HPLC) |
| form | powder |
| color | white to beige |
| solubility | DMSO: 2 mg/mL, clear |
| storage temp. | 2-8°C |
| SMILES string | O=C(C1=CC(OC)=CC(C2=CC=C(OCC)C=C2)=N1)OC(C)C |
| InChI | 1S/C18H21NO4/c1-5-22-14-8-6-13(7-9-14)16-10-15(21-4)11-17(19-16)18(20)23-12(2)3/h6-12H,5H2,1-4H3 |
| InChI key | VYEIBLWRGBQRPI-UHFFFAOYSA-N |
