Application
CD40-TRAF6 signaling inhibitor has been used to treat human embryonic kidney (HEK)-293T cells to test its inhibitory effect on the tumor necrosis factor receptor (TNFR)-associated factor 6 (TRAF6) leading to subsequent abrogation of (P2RY6)-dependent nuclear factor kappa B (NF-κB).
Biochem/physiol Actions
CD40-TRAF6 (cluster of differentiation 40-TNF receptor associated factor) signaling is recognized as an effective target in treating vascular disease.
CD40-TRAF6 signaling inhibitor is a small molecule that binds to TRAF6, blocking interactions with CD40.
CD40-TRAF6 signaling inhibitor is a small molecule that binds to TRAF6, blocking interactions with CD40. The compound inhibits CD40-induced production of IL-1b and IL-6 in primary macrophages. The compound reduces insulin resistance and adipose tissue inflammation in a mouse diet induced obesity model.
| Quality Segment | 100 |
| assay | ≥98% (HPLC) |
| form | powder |
| color | white to beige |
| solubility | DMSO: 20 mg/mL, clear |
| storage temp. | 2-8°C |
| SMILES string | O=C(C1=CC=CC=C1)/C=N/C2=CC(C)=CC=C2C |
| InChI | 1S/C16H15NO/c1-12-8-9-13(2)15(10-12)17-11-16(18)14-6-4-3-5-7-14/h3-11H,1-2H3/b17-11+ |
| InChI key | WIFPLULEUNBSTE-GZTJUZNOSA-N |
