Application
AP-18 is a selective TRPA1 channel blocker. AP-18 blocks the transient receptor potential ankyrin 1 receptors and can reduce chronic pain associated with arthritis. AP-18 reduces cinnamaldehyde-induced nociception in vivo and blocks cold- and mustard oil-induced activation of mouse TRPA1 but not capsaicin-induced activation. AP-18 reverses CFA-induced mechanical hyperalgesia in mice
Biochem/physiol Actions
AP-18 is a selective TRPA1 channel blocker.
AP-18 is a selective TRPA1 channel blocker. Transient receptor potential A1 (TRPA1) plays a central role for chemical sensing in the pain pathway. AP-18 is a novel TRPA1 channel blocker. It reduces cinnamaldehyde-induced nociception in vivo and blocks cold- and mustard oil-induced activation of mouse TRPA1 but not capsaicin-induced activation demonstrating selectivity vs. TRPV11. AP-18 reverses CFA-induced mechanical hyperalgesia in mice.
| Quality Level | 100 |
| assay | ≥98% (HPLC) |
| form | solid |
| color | white to off-white |
| solubility | DMSO: >10 mg/mL |
| storage temp. | 2-8°C |
| SMILES string | CC(=C/c1ccc(Cl)cc1)\C(C)=N\O |
| InChI | 1S/C11H12ClNO/c1-8(9(2)13-14)7-10-3-5-11(12)6-4-10/h3-7,14H,1-2H3/b8-7+,13-9+ |
| InChI key | MHTJEUOFLVQMCL-NJHPPEEMSA-N |

