Biochem/physiol Actions
Triterpene saponin isolated from ginseng that demonstrates a range of pharmacological effects, such as anti-inflammatory, antioxidant, anti-cancer, neuroprotective, and cardiovascular protective properties.
Ginsenoside Rd, a potent triterpene saponin, derived from ginseng demonstrates a range of pharmacological effects, such as anti-inflammatory, antioxidant, anti-cancer, neuroprotective, and cardiovascular protective properties. Potential advantages include enhancing cognitive function, diminishing oxidative stress, and regulating the immune system. Ginsenoside-Rd acts on diverse signaling pathways, including the NF-κB pathway associated with inflammation. Moreover, Ginsenoside Rd is implicated in influencing neuronal function and shielding the brain from oxidative stress.
| Quality Level | 100 |
| assay | ≥98% (HPLC) |
| form | powder |
| optical activity | [α]/D 17 to 23°, c = 0.5 in methanol |
| color | white to beige |
| solubility | DMSO: 2 mg/mL, clear |
| storage temp. | -10 to -25°C |
| SMILES string | C[C@]12[C@@](C[C@H]([C@@]3([H])[C@]2(CC[C@]3([H])[C@@](CCC=C(C)C)(C)O[C@@H]4O[C@@H]([C@H]([C@@H]([C@H]4O)O)O)CO)C)O)([H])[C@@]5([C@@](C(C)([C@H](CC5)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O[C@@H]7O[C@@H]([C@H]([C@@H]([C@H]7O)O)O)CO)C)([H])CC1)C |
