Biochem/physiol Actions
Propidium derivative that allows light-induced crosslinkage to DNA for highly selective live-dead cells analysis by PCR or fluorescence microscopy.
Propidium monoazide (PMA) is a propidium derivative with an azide group that allows crosslinkage to DNA upon light exposure. PMA is only permeable to bacteria with compromised membrane integrity, making it highly selective for sick/dying/dead cells over healthy cells. PMA is typically added to cell samples (50 μM for 1-15 min in the dark) prior to cross-linking induction (650-W halogen light source), washing and DNA extraction. Due to its higher charge, PMA (+2) is less permeant to live cells and more selective than ethidium monoazide/EMA (+1) for dead cells. The stained cells can also be viewed and analyzed by fluorescence microscopy.
| Quality Level | 100 |
| assay | ≥98% (HPLC) |
| form | powder |
| color | red to black |
| solubility | DMSO: 2 mg/mL, clear |
| storage temp. | -10 to -25°C |
| SMILES string | [N-]=[N+]=NC1=CC2=C(C=C1)C3=C(C=C(C=C3)N)[N+](CCC[N+](CC)(C)CC)=C2C4=CC=CC=C4.[Cl-].[Cl-] |
| InChI key | NUMTTYQOTJKZSE-UHFFFAOYSA-M |

