Application
SC-514 has been used to study its effect on lipopolysaccharide (LPS)-induced phosphorylation of NF-κB (nuclear factor-κB) p65 and p38 MAPK (mitogen-activated protein kinase).
Biochem/physiol Actions
SC-514 is an amino-acetamide compound. It is selective for IKKβ with an IC50 value of 3−12 μM. SC-514 also inhibits cytokines such as interleukin-6 (IL-6) and IL-8, mediated by IKKβ. IKKβ is responsible for osteoclast survival, hence its inhibition affects osteogenesis.
SC-514 is a cell-permeable, potent and selective ATP competitive inhibitor of nuclear factor kappa-B kinase-2 (IKK-2).
SC-514 is a cell-permeable, potent and selective ATP competitive inhibitor of nuclear factor kappa-B kinase-2 (IKK-2) that specifically blocks NF-?B-dependent gene expression. SC-514 exhibits anti-inflammatory properties.
| Quality Segment | 100 |
| assay | ≥97% (HPLC) |
| form | powder |
| color | white to light brown |
| solubility | DMSO: 10 mg/mL, clear |
| storage temp. | 2-8°C |
| SMILES string | [s]1c(cc(c1C(=O)N)N)c2c[s]cc2 |
| InChI | 1S/C9H8N2OS2/c10-6-3-7(5-1-2-13-4-5)14-8(6)9(11)12/h1-4H,10H2,(H2,11,12) |
| InChI key | BMUACLADCKCNKZ-UHFFFAOYSA-N |
