Biochem/physiol Actions
Isobavachalcone is a chalcone isolated from multipurpose medical plant Psoralea corylifolia that inhibits LPS-induced ICAM-1 expression and leukocyte adhesion to brain endothelial cells. It appears that isobavachalcone modulates both MyD88-dependent and TRIF-dependent signaling of toll-like receptor 4 (TLR4). Isobavachalcone significantly inhibits both oligomerization and fibrillization of Aβ42. Isobavachalcone exhibits a wide spectrum of biological activities including antioxidative, antiplatelet, antimicrobial, anti-inflammatory, antitumor, and neuroprotective.
Isobavachalcone is a chalcone isolated from multipurpose medical plant Psoralea corylifolia that inhibits LPS-induced ICAM-1 expression and leukocyte adhesion to brain endothelial cells.
| Quality Segment | 100 |
| assay | ≥98% (HPCE) |
| form | powder |
| storage condition | desiccated,protect from light |
| color | white to beige |
| solubility | DMSO: 5 mg/mL, clear (warmed) |
| storage temp. | −20°C |
| SMILES string | OC1=C(CC=C(C)C)C(O)=C(C(/C=C/C2=CC=C(O)C=C2)=O)C=C1 |
| InChI | 1S/C20H20O4/c1-13(2)3-9-16-19(23)12-10-17(20(16)24)18(22)11-6-14-4-7-15(21)8-5-14/h3-8,10-12,21,23-24H,9H2,1-2H3/b11-6+ |
| InChI key | DUWPGRAKHMEPCM-IZZDOVSWSA-N |
