Biochem/physiol Actions
GSK626616 is an orally available, ATP-competitive, potent and selective dual-specificity tyrosine phosphorylation-regulated kinase DYRK inhibitor (DYRK3 IC50 = 0.7 nM; similar potency against DYRK1A and DYRK2) with 20-fold selectivity over the closed related casein kinase 2. GSK626616 enhances Epo-stimulated increase of human marrow erythroid colony formation units (CFU-E), without affecting megakaryocyte colony growth or CFU-GM formation. GSK626616 enhances the percentage and number of Ter119+/CD71+ erythroid progenitors derived from kit+ mouse marrow in the presence of SCF and Epo in cultures, and exhibits therapeutic efficacy in a murine anemia model in vivo (0.03 mg/kg/d i.p.)
Orally available, ATP-competitive, potent and selective dual-specificity tyrosine phosphorylation-regulated kinase DYRK1A/DYRK2/DYRK3 inhibitor in vitro and in vivo.
| Quality Segment | 100 |
| assay | ≥98% (HPLC) |
| form | powder |
| color | white to beige |
| solubility | DMSO: 2 mg/mL, clear |
| storage temp. | −20°C |
| SMILES string | ClC(C=CC=C1Cl)=C1NC2=NC(/C(S2)=C/C3=CC4=C(N=CC=N4)C=C3)=O |
| InChI | 1S/C18H10Cl2N4OS/c19-11-2-1-3-12(20)16(11)23-18-24-17(25)15(26-18)9-10-4-5-13-14(8-10)22-7-6-21-13/h1-9H,(H,23,24,25)/b15-9- |
| InChI key | RJPNRXFBYZVRIB-DHDCSXOGSA-N |
