Application
IKK-16 dihydrochloride has been used as an nuclear factor of kappa light polypeptide gene enhancer in B-cells inhibitor kinase inhibitor (IκB) in B220+ CKO or CreWT naive B cells. It has also been used as a nuclear factor kappa-light-chain-enhancer of activated B cells (NF-κB inhibitor) in poly(I:C) transfection-induced retinoic acid-inducible gene (RIG-I), melanoma differentiation-associated gene 5 (MDA-5), and caspase-11 expressing mouse embryonic fibroblasts (MEFs).
Biochem/physiol Actions
IKK-16 is a selective inhibitor of I
IKK-16 is a selective inhibitor of I
| Quality Segment | 100 |
| assay | ≥98% (HPLC) |
| form | powder |
| storage condition | desiccated |
| color | white to beige |
| solubility | DMSO: 20 mg/mL, clear |
| storage temp. | −20°C |
| SMILES string | O=C(N1CCC(N2CCCC2)CC1)C3=CC=C(NC4=NC=CC(C5=CC(C=CC=C6)=C6S5)=N4)C=C3.C |
| InChI | 1S/C28H29N5OS.CH4/c34-27(33-17-12-23(13-18-33)32-15-3-4-16-32)20-7-9-22(10-8-20)30-28-29-14-11-24(31-28)26-19-21-5-1-2-6-25(21)35-26;/h1-2,5-11,14,19,23H,3-4,12-13,15-18H2,(H,29,30,31);1H4 |
| InChI key | YJGZKHHCMOHIFA-UHFFFAOYSA-N |

