Biochem/physiol Actions
Antioxidant, anti-cancer flavanonol with anti-alcohol intoxication effects, significantly impacts metabolic regulation and cancer chemoprevention through pathways like AMPK and SPHK1/mTOR.Dihydromyricetin (DHM) is a potent flavonoid known for its antioxidative, anti-inflammatory, anticancer, and antimicrobial properties, and plays a key role in modulating metabolism with minimal side effects. It operates by either scavenging or generating reactive oxygen species (ROS) to selectively target cancer cells, while sparing normal cells. DHM acts through multiple pathways including AMPK, affecting autophagy and glucose transport. Additionally, Dihydromyricetin inhibits ferroptosis via the SPHK1/mTOR pathway, modulates the Prx2 cascade through Nrf2, and contributes to cancer prevention and diabetes treatment by altering redox balance, gene expression, and improving metabolism, also involving AMPK, PI3K/Akt, PPAR pathways, and microRNAs.
| Quality Level | 100 |
| assay | ≥98% (HPLC) |
| form | powder |
| storage condition | protect from light |
| color | white to beige |
| solubility | DMSO: 2 mg/mL, clear |
| storage temp. | -10 to -25°C |
| SMILES string | O1[C@@H]([C@H](C(=O)c3c1cc(cc3O)O)O)c2cc(c(c(c2)O)O)O |
| InChI key | KJXSIXMJHKAJOD-LSDHHAIUSA-N |

