General description
Vilanterol trifenatate is a potent and selective beta2 (β2)-adrenoceptor agonist. This bioactive small molecule has been shown to stimulate cellular cAMP accumulation in CHO cells that express human beta2 adrenoceptors, while not having the same effect on beta1 or beta3 receptors (pEC50 = 9.4/β2, 6.4/β1, 6.1/β3). Vilanterol can reduce the contraction of electrically stimulated guinea pig trachea strips and exhibits in vivo therapeutic efficacy in an asthma model in guinea pigs with histamine-induced bronchospasm (EC90 = nebulizer concentration 30 μM). Additionally, Vilanterol trifenatate acts as a substrate for P-glycoprotein (PgP).
Biochem/physiol Actions
Potent and selective, beta2 (β2)-adrenoceptor agonist in vitro and in vivo.
Vilanterol is a potent and selective, beta2 (β2)-adrenoceptor agonist that stimulates cellular cAMP accumulation in CHO cells expressing human beta2, but not beta1 or beta3, adrenoceptor (pEC50 = 9.4/β2, 6.4/β1, 6.1/β3). Vilanterol inhibits the contraction of electrically stimulated guinea pig trachea strips and displays in vivo therapeutic efficacy in a guinea pig asthma model of histamine-induced bronchospasm (EC90 = nebulizer concentration 30 μM).
| Quality Level | 100 |
| assay | ≥95% (HPLC) |
| form | powder |
| storage condition | desiccated |
| color | white to beige |
| solubility | DMSO: 2 mg/mL, clear |
| storage temp. | −20°C |
| SMILES string | OC(C(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3)=O.ClC(C=CC=C4Cl)=C4COCCOCCCCCCNC[C@@H](C5=CC(CO)=C(C=C5)O)O |
| InChI | 1S/C24H33Cl2NO5.C20H16O2/c25-21-6-5-7-22(26)20(21)17-32-13-12-31-11-4-2-1-3-10-27-15-24(30)18-8-9-23(29)19(14-18)16-28;21-19(22)20(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h5-9,14,24,27-30H,1-4,10-13,15-17H2;1-15H,(H,21,22)/t24-;/m0./s1 |
| InChI key | KLOLZALDXGTNQE-JIDHJSLPSA-N |

