Application
TFLLR-NH2 trifluoroacetate salt has been used as a protease-activated receptor-1 (PAR-1) agonist to study its effects on hippocampal CA1 pyramidal neurons and Swell1 knock out mice (cKO).
Biochem/physiol Actions
TFLLR-NH2 is a protease-activated receptor (PARs) agonist which is more selective to PAR-1 than SFLLRN-NH2.
TFLLR-NH2 is a protease-activated receptor (PARs) agonist which is more selective to PAR-1 than SFLLRN-NH2. Protease-activated receptors (PARs) are present on various organs including, plateles, mast cell, gallblader, oesophagus etc, and regulate various physiological processes including human platelet aggregation, vascular contraction/relaxation, and an increase in endothelial permeability. Recent papers indicated that PAR′s are also involved in sensory processing. Specificly PAR ligands enhance glutamatergic excitatory transmission in substantia gelatinosa (SG) neurons of adult rat spinal cord slices.
Preparation Note
TFLLR-NH2 trifluoroacetate is soluble in water at a concentration that is greater than 2 mg/ml.
| Quality Level | 100 |
| assay | >98% (HPLC) |
| form | lyophilized powder |
| color | white to tan |
| solubility | H2O: >2 mg/mL |
| storage temp. | −20°C |
| SMILES string | OC(=O)C(F)(F)F.CC(C)C[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](N)[C@@H](C)O)C(=O)N[C@@H](CCCNC(N)=N)C(N)=O |
| InChI | 1S/C31H53N9O6.C2HF3O2/c1-17(2)14-22(27(43)37-21(26(33)42)12-9-13-36-31(34)35)38-28(44)23(15-18(3)4)39-29(45)24(16-20-10-7-6-8-11-20)40-30(46)25(32)19(5)41;3-2(4,5)1(6)7/h6-8,10-11,17-19,21-25,41H,9,12-16,32H2,1-5H3,(H2,33,42)(H,37,43)(H,38,44)(H,39,45)(H,40,46)(H4,34,35,36);(H,6,7)/t19-,21+,22+,23+,24+,25+;/m1./s1 |
| InChI key | QVNWOGSDGQDGHP-MKVNCOEFSA-N |
