Biochem/physiol Actions
Antifungal against certain species of mold fungi and a superior antibiotic than streptomycin against M. tuberculosis by targeting AHAS catalytic subunit IlvB1.
Originally isolated from Aspergillus candidus Link, Chlorflavonin is a non-cytotoxic (up to 100 μM; MRC-5 and THP-1) antibiotic with antifungal activity against certain species of mold fungi (MIC = 0.08 μg/mL against A. amstelodami, A. fumigalus, A. ochraceous; Paecilomyces variotii MIC = 2.5 μg/mL, Botrytis cinerea MIC = 5 μg/mL). Chlorflavonin also exhibits antibiotic activity against M. tuberculosis (MIC90 = 1.56 μM) by targeting acetohydroxyacid synthase (AHAS) catalytic subunit ilvB1. Chlorflavonin is superior to streptomycin against M. tuberculosis inside infected macrophages, synergizes with isoniazid and delamanid, leading to a complete sterilization in liquid cultures.
| assay | ≥98% (HPLC) |
| form | powder |
| color | white to beige |
| solubility | DMSO: 2 mg/mL, clear |
| storage temp. | 2-8°C |
| SMILES string | OC1=CC(OC)=C(C2=C1C(C(OC)=C(C3=C(O)C(Cl)=CC=C3)O2)=O)OC |
| InChI | 1S/C18H15ClO7/c1-23-11-7-10(20)12-14(22)18(25-3)15(26-17(12)16(11)24-2)8-5-4-6-9(19)13(8)21/h4-7,20-21H,1-3H3 |
| InChI key | JLSQXYITDXJTKL-UHFFFAOYSA-N |
