Biochem/physiol Actions
Histone H3K4 demethylase inhibitor KDM5-C49 ethyl ester prodrug that selectively upregulates H3K4me3 and inhibits KDM5-dependent cancer growth.
KDM5-C70 (KDOAM-21) corresponds to the ethyl ester precursor of a selective αKG-competitive KDM5 histone demethylase inhibitor KDM5-C49 (KDOAM-21; KDM5A/B/C/D Ki = 2/1/6.1/3.4 nM vs. KDM4C/6B/3A/2A Ki = 0.51/4.55/2.59/4.4 μM; KDM5A/B/C/D IC50 = 1.1/0.8/3.2/2.7 μM by FDH assay with [αKG] = 1 mM & [E]/[S] = 0.5/15 μM; KDM5A/B/C IC50 = 25/30/59 nM by alphaLISA with [αKG] = 25 μM & [E]/[S] = 10/100 nM). KDM5-C70 treatment selectively upregulates cellular histone H3 trimethylation on Lys4 (H3K4me3), but not on Lys9/7/36 (5 μM, 3d), and inhibits KDM5-dependent cancer growth (by 85%/MCF7/11d, 97%/BT474/24d, and 70%/ZR-75-1/24d; 5 μM).
| Quality Segment | 100 |
| assay | ≥95% (HPLC) |
| form | oil |
| color | , Light yellow to very dark red-bown |
| storage temp. | -10 to -25°C |
| SMILES string | CN(CCN(C(CNCC1=CC(C(OCC)=O)=CC=N1)=O)CC)C |
| InChI | 1S/C17H28N4O3/c1-5-21(10-9-20(3)4)16(22)13-18-12-15-11-14(7-8-19-15)17(23)24-6-2/h7-8,11,18H,5-6,9-10,12-13H2,1-4H3 |
| InChI key | WCILOMUUNVPIKQ-UHFFFAOYSA-N |
