Biochem/physiol Actions
Potent and selective cyclin-dependent kinase CDK12/13 inhibitor that targets CDK12 Cys1039 and CDK13 Cys1017 for irreversible covalent modification.
THZ531 is a potent, CDK12/13-selective cyclin-dependent kinase inhibitor (IC50 = 158 nM, 69 nM, 10.5 μM, respectively, against 0.2 ?M CDK12-CycK, CDK13-CycK, CDK9-CycT1; IC50 = 8.5 μM against 25 nM CDK7-CycH-MAT1) that targets CDK12 Cys1039 and CDK13 Cys1017 for irreversible covalent modification while bound to the ATP-binding site, displaying good selectivity over >200 other kinases. THZ531 selectively reduces Pol II CTD Ser2, but not Ser5/Ser7, phosphorylation and transcription activity in Jurkat cultures (200-500 nM), exhibiting antiproliferation potency (IC50 = 50 nM in 72 h) due to time- and dose-dependent apoptosis induction.
| Quality Segment | 100 |
| assay | ≥98% (HPLC) |
| form | powder |
| color | white to beige |
| solubility | DMSO: 2 mg/mL, clear |
| storage temp. | −20°C |
| SMILES string | CN(C/C=C/C(NC1=CC=C(C=C1)C(N2CCC[C@H](C2)NC3=NC(C4=CNC5=C4C=CC=C5)=C(C=N3)Cl)=O)=O)C |
| InChI | 1S/C30H32ClN7O2/c1-37(2)15-6-10-27(39)34-21-13-11-20(12-14-21)29(40)38-16-5-7-22(19-38)35-30-33-18-25(31)28(36-30)24-17-32-26-9-4-3-8-23(24)26/h3-4,6,8-14,17-18,22,32H,5,7,15-16,19H2,1-2H3,(H,34,39)(H,33,35,36)/b10-6+/t22-/m1/s1 |
| InChI key | RUBYHLPRZRMTJO-MOVYNIQHSA-N |
