Biochem/physiol Actions
Natural pentacyclic triterpenoid that exhibits anti-inflammatory, antioxidant, and antitumor properties, and enhances cholesterol efflux.
Erythrodiol, also known as Oleanolic alcohol, is a natural triterpene found in olive oil and other plants, known for its multi-faceted pharmacological actions. It displays anti-inflammatory effects by inhibiting pro-inflammatory cytokines and modulating enzymes involved in inflammation. As an antioxidant, it scavenges free radicals, mitigating oxidative stress. In addition, erythrodiol exhibits antitumor properties through antiproliferative activities like inducing cancer cell apoptosis and cell cycle arrest. Erythrodiol also enhances cholesterol efflux in macrophages by increasing the half-life of the ATP-binding cassette transporter A1 (ABCA1) protein, primarily by preventing its degradation.
| Quality Segment | 100 |
| assay | ≥98% (HPLC) |
| form | powder |
| color | white to beige |
| solubility | DMSO: 2 mg/mL, clear (Warmed) |
| storage temp. | -10 to -25°C |
| SMILES string | C[C@@]12C([C@@]3([H])[C@@](CC2)(CCC(C)(C3)C)CO)=CC[C@@]4([H])[C@]1(CC[C@]5([H])[C@@]4(CC[C@@H](C5(C)C)O)C)C |

