Biochem/physiol Actions
TNCA is a tryptophan derivative that binds the parathyroid Ca2+-sensing receptor (CaSR) extracellular domain (ECD) hinge region between two globular subdomains and acts as a high-affinity CaSR ligand (CaSRL) with co-agonist activity.
TNCA is a tryptophan derivative that binds the parathyroid Ca2+-sensing receptor (CaSR) extracellular domain (ECD) hinge region between two globular subdomains and acts as a high-affinity CaSR ligand (CaSRL) with co-agonist activity. TNCA is shown to potentiate both Mg++- and Ca++-evoked cellular calcium response (0.1-0.5 mM), as well as Mg++-evoked cellular ERK1/2 phosphorylation in CaSR-expressing HEK293 cells (0.5 mM). AC-265347 (Cat. No. SML0129), on the other hand, is a calcimimetic that functions as a CaSR agonist.
| Quality Level | 100 |
| assay | ≥98% (HPLC) |
| form | powder |
| optical activity | [α]/D -57 to -67°, c = 1 (in MeOH:1N HCl (1:1)) |
| color | white to beige |
| solubility | 1.5 mg/mL, clear (Solvent: 0.1N HCl:DMSO (1:1); warmed) |
| storage temp. | −20°C |
| SMILES string | O=C(O)[C@H]1NCC2=C(C3=C(N2)C=CC=C3)C1 |
| InChI | 1S/C12H12N2O2/c15-12(16)10-5-8-7-3-1-2-4-9(7)14-11(8)6-13-10/h1-4,10,13-14H,5-6H2,(H,15,16)/t10-/m0/s1 |
| InChI key | FSNCEEGOMTYXKY-JTQLQIEISA-N |
